C13H16N6O5 — CID 23557817
2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-N,N'-bis(methylideneamino)pentanediamide (PubChem CID 23557817) has the molecular formula C13H16N6O5 and a molecular weight of 336.31 g/mol. Its IUPAC name is 2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-N,N'-bis(methylideneamino)pentanediamide.
| Compound Name | 2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-N,N'-bis(methylideneamino)pentanediamide |
|---|---|
| PubChem CID | 23557817 |
| Molecular Formula | C13H16N6O5 |
| Molecular Weight | 336.31 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-N,N'-bis(methylideneamino)pentanediamide |
| SMILES | C=NNC(=O)CCC(NC(=O)CN1C(=O)C=CC1=O)C(=O)NN=C |
| InChI | InChI=1S/C13H16N6O5/c1-14-17-9(20)4-3-8(13(24)18-15-2)16-10(21)7-19-11(22)5-6-12(19)23/h5-6,8H,1-4,7H2,(H,16,21)(H,17,20)(H,18,24) |
| InChIKey | MJMWJKWILWAITJ-UHFFFAOYSA-N |
| XLogP | -2.36 |
| TPSA | 149.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.31 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|