C21H34N12O9 — CID 23557842
N,N'-bis(1,5-dihydrazinyl-1,5-dioxopentan-2-yl)-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]pentanediamide (PubChem CID 23557842) has the molecular formula C21H34N12O9 and a molecular weight of 598.58 g/mol. Its IUPAC name is N,N'-bis(1,5-dihydrazinyl-1,5-dioxopentan-2-yl)-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]pentanediamide.
| Compound Name | N,N'-bis(1,5-dihydrazinyl-1,5-dioxopentan-2-yl)-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]pentanediamide |
|---|---|
| PubChem CID | 23557842 |
| Molecular Formula | C21H34N12O9 |
| Molecular Weight | 598.58 g/mol |
| Exact Mass | 598.26 |
| IUPAC Name | N,N'-bis(1,5-dihydrazinyl-1,5-dioxopentan-2-yl)-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]pentanediamide |
| SMILES | NNC(=O)CCC(NC(=O)CCC(NC(=O)CN1C(=O)C=CC1=O)C(=O)NC(CCC(=O)NN)C(=O)NN)C(=O)NN |
| InChI | InChI=1S/C21H34N12O9/c22-29-14(35)5-2-11(20(41)31-24)26-13(34)4-1-10(27-16(37)9-33-17(38)7-8-18(33)39)19(40)28-12(21(42)32-25)3-6-15(36)30-23/h7-8,10-12H,1-6,9,22-25H2,(H,26,34)(H,27,37)(H,28,40)(H,29,35)(H,30,36)(H,31,41)(H,32,42) |
| InChIKey | RYBFFAARKGLBIH-UHFFFAOYSA-N |
| XLogP | -7.33 |
| TPSA | 345.16 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.58 |
| LogP ≤ 5 | -7.33 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|