C11H15Cl2N3 — CID 23563785
N'-[3-(2,6-dichlorophenyl)propylamino]ethanimidamide (PubChem CID 23563785) has the molecular formula C11H15Cl2N3 and a molecular weight of 260.17 g/mol. Its IUPAC name is N'-[3-(2,6-dichlorophenyl)propylamino]ethanimidamide.
| Compound Name | N'-[3-(2,6-dichlorophenyl)propylamino]ethanimidamide |
|---|---|
| PubChem CID | 23563785 |
| Molecular Formula | C11H15Cl2N3 |
| Molecular Weight | 260.17 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | N'-[3-(2,6-dichlorophenyl)propylamino]ethanimidamide |
| SMILES | C/C(N)=N/NCCCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H15Cl2N3/c1-8(14)16-15-7-3-4-9-10(12)5-2-6-11(9)13/h2,5-6,15H,3-4,7H2,1H3,(H2,14,16) |
| InChIKey | VHXFDXQVGBZUTQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.17 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|