C6H14BNO2 — CID 23568385
2,6-dimethyl-1,3,6,2-dioxazaborocane (PubChem CID 23568385) has the molecular formula C6H14BNO2 and a molecular weight of 143.00 g/mol. Its IUPAC name is 2,6-dimethyl-1,3,6,2-dioxazaborocane.
| Compound Name | 2,6-dimethyl-1,3,6,2-dioxazaborocane |
|---|---|
| PubChem CID | 23568385 |
| Molecular Formula | C6H14BNO2 |
| Molecular Weight | 143.00 g/mol |
| Exact Mass | 143.11 |
| IUPAC Name | 2,6-dimethyl-1,3,6,2-dioxazaborocane |
| SMILES | CB1OCCN(C)CCO1 |
| InChI | InChI=1S/C6H14BNO2/c1-7-9-5-3-8(2)4-6-10-7/h3-6H2,1-2H3 |
| InChIKey | ZCOJIYPWRRIQAW-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.00 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|