C23H37NO8 — CID 23571697
[2-[1,3-bis(prop-1-en-2-yloxymethoxy)propan-2-yloxycarbonylamino]-5-methylhex-5-enyl] 2-methylprop-2-enoate (PubChem CID 23571697) has the molecular formula C23H37NO8 and a molecular weight of 455.55 g/mol. Its IUPAC name is [2-[1,3-bis(prop-1-en-2-yloxymethoxy)propan-2-yloxycarbonylamino]-5-methylhex-5-enyl] 2-methylprop-2-enoate.
| Compound Name | [2-[1,3-bis(prop-1-en-2-yloxymethoxy)propan-2-yloxycarbonylamino]-5-methylhex-5-enyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 23571697 |
| Molecular Formula | C23H37NO8 |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | [2-[1,3-bis(prop-1-en-2-yloxymethoxy)propan-2-yloxycarbonylamino]-5-methylhex-5-enyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)CCC(COC(=O)C(=C)C)NC(=O)OC(COCOC(=C)C)COCOC(=C)C |
| InChI | InChI=1S/C23H37NO8/c1-16(2)9-10-20(11-29-22(25)17(3)4)24-23(26)32-21(12-27-14-30-18(5)6)13-28-15-31-19(7)8/h20-21H,1,3,5,7,9-15H2,2,4,6,8H3,(H,24,26) |
| InChIKey | ZYCKDSFLFDMQGP-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|