C18H19NO — CID 23623929
3-oxatetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),2(4),5,7,9,12,14-heptaene;propan-1-amine (PubChem CID 23623929) has the molecular formula C18H19NO and a molecular weight of 265.36 g/mol. Its IUPAC name is 3-oxatetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),2(4),5,7,9,12,14-heptaene;propan-1-amine.
| Compound Name | 3-oxatetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),2(4),5,7,9,12,14-heptaene;propan-1-amine |
|---|---|
| PubChem CID | 23623929 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 3-oxatetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),2(4),5,7,9,12,14-heptaene;propan-1-amine |
| SMILES | CCCN.c1ccc2c(c1)Cc1ccccc1C1=C2O1 |
| InChI | InChI=1S/C15H10O.C3H9N/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)15-14(12)16-15;1-2-3-4/h1-8H,9H2;2-4H2,1H3 |
| InChIKey | BVQYTZBQPFWWRG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 38.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|