C37H53N2+ — CID 23639078
(2Z)-1-methyl-2-[(E)-3-[1-methyl-3,3-bis(2-methylpropyl)indol-1-ium-2-yl]prop-2-enylidene]-3,3-bis(2-methylpropyl)indole (PubChem CID 23639078) has the molecular formula C37H53N2+ and a molecular weight of 525.85 g/mol. Its IUPAC name is (2Z)-1-methyl-2-[(E)-3-[1-methyl-3,3-bis(2-methylpropyl)indol-1-ium-2-yl]prop-2-enylidene]-3,3-bis(2-methylpropyl)indole.
| Compound Name | (2Z)-1-methyl-2-[(E)-3-[1-methyl-3,3-bis(2-methylpropyl)indol-1-ium-2-yl]prop-2-enylidene]-3,3-bis(2-methylpropyl)indole |
|---|---|
| PubChem CID | 23639078 |
| Molecular Formula | C37H53N2+ |
| Molecular Weight | 525.85 g/mol |
| Exact Mass | 525.42 |
| IUPAC Name | (2Z)-1-methyl-2-[(E)-3-[1-methyl-3,3-bis(2-methylpropyl)indol-1-ium-2-yl]prop-2-enylidene]-3,3-bis(2-methylpropyl)indole |
| SMILES | CC(C)CC1(CC(C)C)C(/C=C/C=C2\N(C)c3ccccc3C2(CC(C)C)CC(C)C)=[N+](C)c2ccccc21 |
| InChI | InChI=1S/C37H53N2/c1-26(2)22-36(23-27(3)4)30-16-11-13-18-32(30)38(9)34(36)20-15-21-35-37(24-28(5)6,25-29(7)8)31-17-12-14-19-33(31)39(35)10/h11-21,26-29H,22-25H2,1-10H3/q+1 |
| InChIKey | ZLAAMNIQMOXRJS-UHFFFAOYSA-N |
| XLogP | 9.67 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.85 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|