C26H29F2N5O3 — CID 23647887
6-(2,4-diamino-6-ethylpyrimidin-5-yl)-2-(3,5-difluorophenyl)-2-ethyl-4-(3-methoxypropyl)-1,4-benzoxazin-3-one (PubChem CID 23647887) has the molecular formula C26H29F2N5O3 and a molecular weight of 497.55 g/mol. Its IUPAC name is 6-(2,4-diamino-6-ethylpyrimidin-5-yl)-2-(3,5-difluorophenyl)-2-ethyl-4-(3-methoxypropyl)-1,4-benzoxazin-3-one.
| Compound Name | 6-(2,4-diamino-6-ethylpyrimidin-5-yl)-2-(3,5-difluorophenyl)-2-ethyl-4-(3-methoxypropyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 23647887 |
| Molecular Formula | C26H29F2N5O3 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | 6-(2,4-diamino-6-ethylpyrimidin-5-yl)-2-(3,5-difluorophenyl)-2-ethyl-4-(3-methoxypropyl)-1,4-benzoxazin-3-one |
| SMILES | CCc1nc(N)nc(N)c1-c1ccc2c(c1)N(CCCOC)C(=O)C(CC)(c1cc(F)cc(F)c1)O2 |
| InChI | InChI=1S/C26H29F2N5O3/c1-4-19-22(23(29)32-25(30)31-19)15-7-8-21-20(11-15)33(9-6-10-35-3)24(34)26(5-2,36-21)16-12-17(27)14-18(28)13-16/h7-8,11-14H,4-6,9-10H2,1-3H3,(H4,29,30,31,32) |
| InChIKey | ICDYHYNUXPDZEQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|