C15H16N4O4S — CID 23762905
1-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-3-pyridin-3-ylthiourea (PubChem CID 23762905) has the molecular formula C15H16N4O4S and a molecular weight of 348.38 g/mol. Its IUPAC name is 1-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-3-pyridin-3-ylthiourea.
| Compound Name | 1-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-3-pyridin-3-ylthiourea |
|---|---|
| PubChem CID | 23762905 |
| Molecular Formula | C15H16N4O4S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 1-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-3-pyridin-3-ylthiourea |
| SMILES | O=[N+]([O-])c1ccc(C(O)C(CO)NC(=S)Nc2cccnc2)cc1 |
| InChI | InChI=1S/C15H16N4O4S/c20-9-13(18-15(24)17-11-2-1-7-16-8-11)14(21)10-3-5-12(6-4-10)19(22)23/h1-8,13-14,20-21H,9H2,(H2,17,18,24) |
| InChIKey | OZXAEQVWMCYRHY-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 120.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|