C17H19N3O5S — CID 3543721
1-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-3-(2-methoxyphenyl)thiourea (PubChem CID 3543721) has the molecular formula C17H19N3O5S and a molecular weight of 377.42 g/mol. Its IUPAC name is 1-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-3-(2-methoxyphenyl)thiourea.
| Compound Name | 1-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-3-(2-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 3543721 |
| Molecular Formula | C17H19N3O5S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 1-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-3-(2-methoxyphenyl)thiourea |
| SMILES | COc1ccccc1NC(=S)NC(CO)C(O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H19N3O5S/c1-25-15-5-3-2-4-13(15)18-17(26)19-14(10-21)16(22)11-6-8-12(9-7-11)20(23)24/h2-9,14,16,21-22H,10H2,1H3,(H2,18,19,26) |
| InChIKey | USCLFSFDAOHFSM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 116.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|