C25H30N2O4S — CID 23804074
1-(4-methoxyphenyl)-3-[[6-(2-methylpropyl)-3-pentanoyl-2-pyridinyl]sulfanyl]pyrrolidine-2,5-dione (PubChem CID 23804074) has the molecular formula C25H30N2O4S and a molecular weight of 454.59 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-[[6-(2-methylpropyl)-3-pentanoyl-2-pyridinyl]sulfanyl]pyrrolidine-2,5-dione.
| Compound Name | 1-(4-methoxyphenyl)-3-[[6-(2-methylpropyl)-3-pentanoyl-2-pyridinyl]sulfanyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 23804074 |
| Molecular Formula | C25H30N2O4S |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-[[6-(2-methylpropyl)-3-pentanoyl-2-pyridinyl]sulfanyl]pyrrolidine-2,5-dione |
| SMILES | CCCCC(=O)c1ccc(CC(C)C)nc1SC1CC(=O)N(c2ccc(OC)cc2)C1=O |
| InChI | InChI=1S/C25H30N2O4S/c1-5-6-7-21(28)20-13-8-17(14-16(2)3)26-24(20)32-22-15-23(29)27(25(22)30)18-9-11-19(31-4)12-10-18/h8-13,16,22H,5-7,14-15H2,1-4H3 |
| InChIKey | YWLGSCIBLGZTAW-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|