C31H50N6 — CID 23816126
2-N-(1-adamantyl)-4-N-(2-adamantyl)-6-N-octyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 23816126) has the molecular formula C31H50N6 and a molecular weight of 506.78 g/mol. Its IUPAC name is 2-N-(1-adamantyl)-4-N-(2-adamantyl)-6-N-octyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-(1-adamantyl)-4-N-(2-adamantyl)-6-N-octyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 23816126 |
| Molecular Formula | C31H50N6 |
| Molecular Weight | 506.78 g/mol |
| Exact Mass | 506.41 |
| IUPAC Name | 2-N-(1-adamantyl)-4-N-(2-adamantyl)-6-N-octyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCCCCCCNc1nc(NC2C3CC4CC(C3)CC2C4)nc(NC23CC4CC(CC(C4)C2)C3)n1 |
| InChI | InChI=1S/C31H50N6/c1-2-3-4-5-6-7-8-32-28-34-29(33-27-25-13-20-9-21(15-25)16-26(27)14-20)36-30(35-28)37-31-17-22-10-23(18-31)12-24(11-22)19-31/h20-27H,2-19H2,1H3,(H3,32,33,34,35,36,37) |
| InChIKey | MUGSMHUNMUAVDK-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.78 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|