C17H18N2O5 — CID 23863740
(3S,5S,6R,9S)-6-(4-hydroxyphenyl)-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecane-5-carboxylic acid (PubChem CID 23863740) has the molecular formula C17H18N2O5 and a molecular weight of 330.34 g/mol. Its IUPAC name is (3S,5S,6R,9S)-6-(4-hydroxyphenyl)-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecane-5-carboxylic acid.
| Compound Name | (3S,5S,6R,9S)-6-(4-hydroxyphenyl)-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecane-5-carboxylic acid |
|---|---|
| PubChem CID | 23863740 |
| Molecular Formula | C17H18N2O5 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | (3S,5S,6R,9S)-6-(4-hydroxyphenyl)-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecane-5-carboxylic acid |
| SMILES | O=C(O)[C@H]1C[C@H]2C(=O)N3CCC[C@H]3C(=O)N2[C@H]1c1ccc(O)cc1 |
| InChI | InChI=1S/C17H18N2O5/c20-10-5-3-9(4-6-10)14-11(17(23)24)8-13-15(21)18-7-1-2-12(18)16(22)19(13)14/h3-6,11-14,20H,1-2,7-8H2,(H,23,24)/t11-,12-,13-,14-/m0/s1 |
| InChIKey | YBLUXSAJPKBEGV-XUXIUFHCSA-N |
| XLogP | 0.74 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |