C21H17N3O7 — CID 23876209
N-[3-cyano-5-(3-nitrophenyl)furan-2-yl]-3,4,5-trimethoxybenzamide (PubChem CID 23876209) has the molecular formula C21H17N3O7 and a molecular weight of 423.38 g/mol. Its IUPAC name is N-[3-cyano-5-(3-nitrophenyl)furan-2-yl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[3-cyano-5-(3-nitrophenyl)furan-2-yl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 23876209 |
| Molecular Formula | C21H17N3O7 |
| Molecular Weight | 423.38 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | N-[3-cyano-5-(3-nitrophenyl)furan-2-yl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2oc(-c3cccc([N+](=O)[O-])c3)cc2C#N)cc(OC)c1OC |
| InChI | InChI=1S/C21H17N3O7/c1-28-17-8-13(9-18(29-2)19(17)30-3)20(25)23-21-14(11-22)10-16(31-21)12-5-4-6-15(7-12)24(26)27/h4-10H,1-3H3,(H,23,25) |
| InChIKey | VSBPSLCPEOHLJM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 136.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|