C20H16N6O8 — CID 102174670
N-[4-cyano-1-(2,4-dinitrophenyl)pyrazol-5-yl]-3,4,5-trimethoxybenzamide (PubChem CID 102174670) has the molecular formula C20H16N6O8 and a molecular weight of 468.38 g/mol. Its IUPAC name is N-[4-cyano-1-(2,4-dinitrophenyl)pyrazol-5-yl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[4-cyano-1-(2,4-dinitrophenyl)pyrazol-5-yl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 102174670 |
| Molecular Formula | C20H16N6O8 |
| Molecular Weight | 468.38 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | N-[4-cyano-1-(2,4-dinitrophenyl)pyrazol-5-yl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2c(C#N)cnn2-c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc(OC)c1OC |
| InChI | InChI=1S/C20H16N6O8/c1-32-16-6-11(7-17(33-2)18(16)34-3)20(27)23-19-12(9-21)10-22-24(19)14-5-4-13(25(28)29)8-15(14)26(30)31/h4-8,10H,1-3H3,(H,23,27) |
| InChIKey | KHSMIUDQDGMDHQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 184.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|