C15H21N3O3S — CID 2387774
1-prop-2-enyl-3-[1-(3,4,5-trimethoxyphenyl)ethenylamino]thiourea (PubChem CID 2387774) has the molecular formula C15H21N3O3S and a molecular weight of 323.42 g/mol. Its IUPAC name is 1-prop-2-enyl-3-[1-(3,4,5-trimethoxyphenyl)ethenylamino]thiourea.
| Compound Name | 1-prop-2-enyl-3-[1-(3,4,5-trimethoxyphenyl)ethenylamino]thiourea |
|---|---|
| PubChem CID | 2387774 |
| Molecular Formula | C15H21N3O3S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 1-prop-2-enyl-3-[1-(3,4,5-trimethoxyphenyl)ethenylamino]thiourea |
| SMILES | C=CCNC(=S)NNC(=C)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C15H21N3O3S/c1-6-7-16-15(22)18-17-10(2)11-8-12(19-3)14(21-5)13(9-11)20-4/h6,8-9,17H,1-2,7H2,3-5H3,(H2,16,18,22) |
| InChIKey | SATKOKZJHTUNDL-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 63.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|