C15H23N3O3S — CID 2470145
1-propan-2-yl-3-[1-(3,4,5-trimethoxyphenyl)ethenylamino]thiourea (PubChem CID 2470145) has the molecular formula C15H23N3O3S and a molecular weight of 325.43 g/mol. Its IUPAC name is 1-propan-2-yl-3-[1-(3,4,5-trimethoxyphenyl)ethenylamino]thiourea.
| Compound Name | 1-propan-2-yl-3-[1-(3,4,5-trimethoxyphenyl)ethenylamino]thiourea |
|---|---|
| PubChem CID | 2470145 |
| Molecular Formula | C15H23N3O3S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 1-propan-2-yl-3-[1-(3,4,5-trimethoxyphenyl)ethenylamino]thiourea |
| SMILES | C=C(NNC(=S)NC(C)C)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C15H23N3O3S/c1-9(2)16-15(22)18-17-10(3)11-7-12(19-4)14(21-6)13(8-11)20-5/h7-9,17H,3H2,1-2,4-6H3,(H2,16,18,22) |
| InChIKey | INQVJMIEYNIEBN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 63.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|