C14H24N2S2 — CID 23903414
5-cyclohexyl-3-cyclopentyl-1,3,5-thiadiazinane-2-thione (PubChem CID 23903414) has the molecular formula C14H24N2S2 and a molecular weight of 284.49 g/mol. Its IUPAC name is 5-cyclohexyl-3-cyclopentyl-1,3,5-thiadiazinane-2-thione.
| Compound Name | 5-cyclohexyl-3-cyclopentyl-1,3,5-thiadiazinane-2-thione |
|---|---|
| PubChem CID | 23903414 |
| Molecular Formula | C14H24N2S2 |
| Molecular Weight | 284.49 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 5-cyclohexyl-3-cyclopentyl-1,3,5-thiadiazinane-2-thione |
| SMILES | S=C1SCN(C2CCCCC2)CN1C1CCCC1 |
| InChI | InChI=1S/C14H24N2S2/c17-14-16(13-8-4-5-9-13)10-15(11-18-14)12-6-2-1-3-7-12/h12-13H,1-11H2 |
| InChIKey | YKXAKAKXGSILNL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.49 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|