C23H39N4PS — CID 23908864
1-[bis(azepan-1-yl)-tert-butyl-λ5-phosphanylidene]-3-phenylthiourea (PubChem CID 23908864) has the molecular formula C23H39N4PS and a molecular weight of 434.63 g/mol. Its IUPAC name is 1-[bis(azepan-1-yl)-tert-butyl-λ5-phosphanylidene]-3-phenylthiourea.
| Compound Name | 1-[bis(azepan-1-yl)-tert-butyl-λ5-phosphanylidene]-3-phenylthiourea |
|---|---|
| PubChem CID | 23908864 |
| Molecular Formula | C23H39N4PS |
| Molecular Weight | 434.63 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | 1-[bis(azepan-1-yl)-tert-butyl-λ5-phosphanylidene]-3-phenylthiourea |
| SMILES | CC(C)(C)P(=NC(=S)Nc1ccccc1)(N1CCCCCC1)N1CCCCCC1 |
| InChI | InChI=1S/C23H39N4PS/c1-23(2,3)28(26-17-11-4-5-12-18-26,27-19-13-6-7-14-20-27)25-22(29)24-21-15-9-8-10-16-21/h8-10,15-16H,4-7,11-14,17-20H2,1-3H3,(H,24,29) |
| InChIKey | UFNMCYBGXUYQPY-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.63 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|