C30H46N5OPS — CID 4097207
1-[bis(azepan-1-yl)-tert-butyl-λ5-phosphanylidene]-3-[4-(2-methoxyanilino)phenyl]thiourea (PubChem CID 4097207) has the molecular formula C30H46N5OPS and a molecular weight of 555.77 g/mol. Its IUPAC name is 1-[bis(azepan-1-yl)-tert-butyl-λ5-phosphanylidene]-3-[4-(2-methoxyanilino)phenyl]thiourea.
| Compound Name | 1-[bis(azepan-1-yl)-tert-butyl-λ5-phosphanylidene]-3-[4-(2-methoxyanilino)phenyl]thiourea |
|---|---|
| PubChem CID | 4097207 |
| Molecular Formula | C30H46N5OPS |
| Molecular Weight | 555.77 g/mol |
| Exact Mass | 555.32 |
| IUPAC Name | 1-[bis(azepan-1-yl)-tert-butyl-λ5-phosphanylidene]-3-[4-(2-methoxyanilino)phenyl]thiourea |
| SMILES | COc1ccccc1Nc1ccc(NC(=S)N=P(N2CCCCCC2)(N2CCCCCC2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C30H46N5OPS/c1-30(2,3)37(34-21-11-5-6-12-22-34,35-23-13-7-8-14-24-35)33-29(38)32-26-19-17-25(18-20-26)31-27-15-9-10-16-28(27)36-4/h9-10,15-20,31H,5-8,11-14,21-24H2,1-4H3,(H,32,38) |
| InChIKey | WBIKOANLPMATBN-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.77 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|