C24H33N3O3S — CID 23936418
N-prop-2-enyl-4-(3,4,5-trimethoxyphenyl)-3-[(3,3,5-trimethylcyclohexylidene)amino]-1,3-thiazol-2-imine (PubChem CID 23936418) has the molecular formula C24H33N3O3S and a molecular weight of 443.61 g/mol. Its IUPAC name is N-prop-2-enyl-4-(3,4,5-trimethoxyphenyl)-3-[(3,3,5-trimethylcyclohexylidene)amino]-1,3-thiazol-2-imine.
| Compound Name | N-prop-2-enyl-4-(3,4,5-trimethoxyphenyl)-3-[(3,3,5-trimethylcyclohexylidene)amino]-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23936418 |
| Molecular Formula | C24H33N3O3S |
| Molecular Weight | 443.61 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | N-prop-2-enyl-4-(3,4,5-trimethoxyphenyl)-3-[(3,3,5-trimethylcyclohexylidene)amino]-1,3-thiazol-2-imine |
| SMILES | C=CC/N=c1\scc(-c2cc(OC)c(OC)c(OC)c2)n1N=C1CC(C)CC(C)(C)C1 |
| InChI | InChI=1S/C24H33N3O3S/c1-8-9-25-23-27(26-18-10-16(2)13-24(3,4)14-18)19(15-31-23)17-11-20(28-5)22(30-7)21(12-17)29-6/h8,11-12,15-16H,1,9-10,13-14H2,2-7H3/b25-23-,26-18? |
| InChIKey | WQLILAACDDMJOM-KLAFABQSSA-N |
| XLogP | 5.38 |
| TPSA | 57.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.61 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|