C18H17BrN4O4S2 — CID 24628250
1-(5-bromothiophen-2-yl)sulfonyl-N-(4-oxoquinazolin-3-yl)piperidine-3-carboxamide (PubChem CID 24628250) has the molecular formula C18H17BrN4O4S2 and a molecular weight of 497.40 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)sulfonyl-N-(4-oxoquinazolin-3-yl)piperidine-3-carboxamide.
| Compound Name | 1-(5-bromothiophen-2-yl)sulfonyl-N-(4-oxoquinazolin-3-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 24628250 |
| Molecular Formula | C18H17BrN4O4S2 |
| Molecular Weight | 497.40 g/mol |
| Exact Mass | 495.99 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)sulfonyl-N-(4-oxoquinazolin-3-yl)piperidine-3-carboxamide |
| SMILES | O=C(Nn1cnc2ccccc2c1=O)C1CCCN(S(=O)(=O)c2ccc(Br)s2)C1 |
| InChI | InChI=1S/C18H17BrN4O4S2/c19-15-7-8-16(28-15)29(26,27)22-9-3-4-12(10-22)17(24)21-23-11-20-14-6-2-1-5-13(14)18(23)25/h1-2,5-8,11-12H,3-4,9-10H2,(H,21,24) |
| InChIKey | YVQQVGWIXMRFAD-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |