C29H42N2O4 — CID 24742656
5-[3,5-bis[(E)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]pyrazol-1-yl]oxolane-2,3,4-triol (PubChem CID 24742656) has the molecular formula C29H42N2O4 and a molecular weight of 482.67 g/mol. Its IUPAC name is 5-[3,5-bis[(E)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]pyrazol-1-yl]oxolane-2,3,4-triol.
| Compound Name | 5-[3,5-bis[(E)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]pyrazol-1-yl]oxolane-2,3,4-triol |
|---|---|
| PubChem CID | 24742656 |
| Molecular Formula | C29H42N2O4 |
| Molecular Weight | 482.67 g/mol |
| Exact Mass | 482.31 |
| IUPAC Name | 5-[3,5-bis[(E)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]pyrazol-1-yl]oxolane-2,3,4-triol |
| SMILES | CC1=C(/C=C/c2cc(/C=C/C3=C(C)CCCC3(C)C)n(C3OC(O)C(O)C3O)n2)C(C)(C)CCC1 |
| InChI | InChI=1S/C29H42N2O4/c1-18-9-7-15-28(3,4)22(18)13-11-20-17-21(12-14-23-19(2)10-8-16-29(23,5)6)31(30-20)26-24(32)25(33)27(34)35-26/h11-14,17,24-27,32-34H,7-10,15-16H2,1-6H3/b13-11+,14-12+ |
| InChIKey | UOOFMUGEAOHWQH-PHEQNACWSA-N |
| XLogP | 5.53 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.67 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |