C27H39ClN2 — CID 24742654
1-(2-chloroethyl)-3,5-bis[(E)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]pyrazole (PubChem CID 24742654) has the molecular formula C27H39ClN2 and a molecular weight of 427.08 g/mol. Its IUPAC name is 1-(2-chloroethyl)-3,5-bis[(E)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]pyrazole.
| Compound Name | 1-(2-chloroethyl)-3,5-bis[(E)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]pyrazole |
|---|---|
| PubChem CID | 24742654 |
| Molecular Formula | C27H39ClN2 |
| Molecular Weight | 427.08 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | 1-(2-chloroethyl)-3,5-bis[(E)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]pyrazole |
| SMILES | CC1=C(/C=C/c2cc(/C=C/C3=C(C)CCCC3(C)C)n(CCCl)n2)C(C)(C)CCC1 |
| InChI | InChI=1S/C27H39ClN2/c1-20-9-7-15-26(3,4)24(20)13-11-22-19-23(30(29-22)18-17-28)12-14-25-21(2)10-8-16-27(25,5)6/h11-14,19H,7-10,15-18H2,1-6H3/b13-11+,14-12+ |
| InChIKey | SHANEDWPRXBGOC-PHEQNACWSA-N |
| XLogP | 8.20 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.08 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|