C15H23N5 — CID 23583649
4-hydrazinyl-6-[(E)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]pyrimidin-2-amine (PubChem CID 23583649) has the molecular formula C15H23N5 and a molecular weight of 273.38 g/mol. Its IUPAC name is 4-hydrazinyl-6-[(E)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]pyrimidin-2-amine.
| Compound Name | 4-hydrazinyl-6-[(E)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 23583649 |
| Molecular Formula | C15H23N5 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.20 |
| IUPAC Name | 4-hydrazinyl-6-[(E)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]pyrimidin-2-amine |
| SMILES | CC1=C(/C=C/c2cc(NN)nc(N)n2)C(C)(C)CCC1 |
| InChI | InChI=1S/C15H23N5/c1-10-5-4-8-15(2,3)12(10)7-6-11-9-13(20-17)19-14(16)18-11/h6-7,9H,4-5,8,17H2,1-3H3,(H3,16,18,19,20)/b7-6+ |
| InChIKey | ZWDLEPKSXCHANM-VOTSOKGWSA-N |
| XLogP | 2.88 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|