C28H33N3O4 — CID 24760960
ethyl 4-[5-[(4-tert-butylbenzoyl)amino]-1-oxoisoquinolin-2-yl]piperidine-1-carboxylate (PubChem CID 24760960) has the molecular formula C28H33N3O4 and a molecular weight of 475.59 g/mol. Its IUPAC name is ethyl 4-[5-[(4-tert-butylbenzoyl)amino]-1-oxoisoquinolin-2-yl]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[5-[(4-tert-butylbenzoyl)amino]-1-oxoisoquinolin-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 24760960 |
| Molecular Formula | C28H33N3O4 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | ethyl 4-[5-[(4-tert-butylbenzoyl)amino]-1-oxoisoquinolin-2-yl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(n2ccc3c(NC(=O)c4ccc(C(C)(C)C)cc4)cccc3c2=O)CC1 |
| InChI | InChI=1S/C28H33N3O4/c1-5-35-27(34)30-16-13-21(14-17-30)31-18-15-22-23(26(31)33)7-6-8-24(22)29-25(32)19-9-11-20(12-10-19)28(2,3)4/h6-12,15,18,21H,5,13-14,16-17H2,1-4H3,(H,29,32) |
| InChIKey | ZKQAORQAOPLDBN-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |