C22H25N2O9P — CID 24763171
methyl 4-[2-[[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methoxy]-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-6-yl]butanoate (PubChem CID 24763171) has the molecular formula C22H25N2O9P and a molecular weight of 492.42 g/mol. Its IUPAC name is methyl 4-[2-[[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methoxy]-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-6-yl]butanoate.
| Compound Name | methyl 4-[2-[[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methoxy]-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-6-yl]butanoate |
|---|---|
| PubChem CID | 24763171 |
| Molecular Formula | C22H25N2O9P |
| Molecular Weight | 492.42 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | methyl 4-[2-[[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methoxy]-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-6-yl]butanoate |
| SMILES | COC(=O)CCCc1ccc2c(c1)COP(=O)(OC[C@@H]1C=C[C@H](n3cc(C)c(=O)[nH]c3=O)O1)O2 |
| InChI | InChI=1S/C22H25N2O9P/c1-14-11-24(22(27)23-21(14)26)19-9-7-17(32-19)13-31-34(28)30-12-16-10-15(6-8-18(16)33-34)4-3-5-20(25)29-2/h6-11,17,19H,3-5,12-13H2,1-2H3,(H,23,26,27)/t17-,19+,34?/m0/s1 |
| InChIKey | OCZXSYZASLWYGF-UFNPCRCWSA-N |
| XLogP | 2.53 |
| TPSA | 135.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|