C19H21N2O6P — CID 101038638
1-[(2R,5S)-5-[(6,8-dimethyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)methyl]-2,5-dihydrofuran-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 101038638) has the molecular formula C19H21N2O6P and a molecular weight of 404.36 g/mol. Its IUPAC name is 1-[(2R,5S)-5-[(6,8-dimethyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)methyl]-2,5-dihydrofuran-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5S)-5-[(6,8-dimethyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)methyl]-2,5-dihydrofuran-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 101038638 |
| Molecular Formula | C19H21N2O6P |
| Molecular Weight | 404.36 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 1-[(2R,5S)-5-[(6,8-dimethyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)methyl]-2,5-dihydrofuran-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cc(C)c2c(c1)COP(=O)(C[C@@H]1C=C[C@H](n3cc(C)c(=O)[nH]c3=O)O1)O2 |
| InChI | InChI=1S/C19H21N2O6P/c1-11-6-12(2)17-14(7-11)9-25-28(24,27-17)10-15-4-5-16(26-15)21-8-13(3)18(22)20-19(21)23/h4-8,15-16H,9-10H2,1-3H3,(H,20,22,23)/t15-,16+,28?/m0/s1 |
| InChIKey | UCCSJHWOTPHNNZ-WCWIVZKHSA-N |
| XLogP | 2.72 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.36 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|