C23H27N2O8P — CID 25180310
1-[(2R,5S)-5-[[(2R)-6-acetyl-8-tert-butyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl]oxymethyl]-2,5-dihydrofuran-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 25180310) has the molecular formula C23H27N2O8P and a molecular weight of 490.45 g/mol. Its IUPAC name is 1-[(2R,5S)-5-[[(2R)-6-acetyl-8-tert-butyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl]oxymethyl]-2,5-dihydrofuran-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5S)-5-[[(2R)-6-acetyl-8-tert-butyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl]oxymethyl]-2,5-dihydrofuran-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 25180310 |
| Molecular Formula | C23H27N2O8P |
| Molecular Weight | 490.45 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | 1-[(2R,5S)-5-[[(2R)-6-acetyl-8-tert-butyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl]oxymethyl]-2,5-dihydrofuran-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | CC(=O)c1cc2c(c(C(C)(C)C)c1)O[P@@](=O)(OC[C@@H]1C=C[C@H](n3cc(C)c(=O)[nH]c3=O)O1)OC2 |
| InChI | InChI=1S/C23H27N2O8P/c1-13-10-25(22(28)24-21(13)27)19-7-6-17(32-19)12-31-34(29)30-11-16-8-15(14(2)26)9-18(20(16)33-34)23(3,4)5/h6-10,17,19H,11-12H2,1-5H3,(H,24,27,28)/t17-,19+,34+/m0/s1 |
| InChIKey | SAHPAIPPJXJPLX-QVNBXFRASA-N |
| XLogP | 3.53 |
| TPSA | 125.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.45 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|