C26H31N2O11P — CID 25139742
[acetyloxy-[6-tert-butyl-2-[[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methoxy]-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-8-yl]methyl] acetate (PubChem CID 25139742) has the molecular formula C26H31N2O11P and a molecular weight of 578.51 g/mol. Its IUPAC name is [acetyloxy-[6-tert-butyl-2-[[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methoxy]-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-8-yl]methyl] acetate.
| Compound Name | [acetyloxy-[6-tert-butyl-2-[[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methoxy]-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-8-yl]methyl] acetate |
|---|---|
| PubChem CID | 25139742 |
| Molecular Formula | C26H31N2O11P |
| Molecular Weight | 578.51 g/mol |
| Exact Mass | 578.17 |
| IUPAC Name | [acetyloxy-[6-tert-butyl-2-[[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methoxy]-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-8-yl]methyl] acetate |
| SMILES | CC(=O)OC(OC(C)=O)c1cc(C(C)(C)C)cc2c1OP(=O)(OC[C@@H]1C=C[C@H](n3cc(C)c(=O)[nH]c3=O)O1)OC2 |
| InChI | InChI=1S/C26H31N2O11P/c1-14-11-28(25(32)27-23(14)31)21-8-7-19(38-21)13-35-40(33)34-12-17-9-18(26(4,5)6)10-20(22(17)39-40)24(36-15(2)29)37-16(3)30/h7-11,19,21,24H,12-13H2,1-6H3,(H,27,31,32)/t19-,21+,40?/m0/s1 |
| InChIKey | KWZUYCXCMSYPSK-HSIIAARLSA-N |
| XLogP | 3.45 |
| TPSA | 161.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.51 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|