C19H26ClNO4 — CID 24824147
(2R,3R,5Z,8R)-3-chloro-2-[(4-methoxyphenyl)methoxymethyl]-N,N-dimethyl-3,4,7,8-tetrahydro-2H-oxocine-8-carboxamide (PubChem CID 24824147) has the molecular formula C19H26ClNO4 and a molecular weight of 367.87 g/mol. Its IUPAC name is (2R,3R,5Z,8R)-3-chloro-2-[(4-methoxyphenyl)methoxymethyl]-N,N-dimethyl-3,4,7,8-tetrahydro-2H-oxocine-8-carboxamide.
| Compound Name | (2R,3R,5Z,8R)-3-chloro-2-[(4-methoxyphenyl)methoxymethyl]-N,N-dimethyl-3,4,7,8-tetrahydro-2H-oxocine-8-carboxamide |
|---|---|
| PubChem CID | 24824147 |
| Molecular Formula | C19H26ClNO4 |
| Molecular Weight | 367.87 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | (2R,3R,5Z,8R)-3-chloro-2-[(4-methoxyphenyl)methoxymethyl]-N,N-dimethyl-3,4,7,8-tetrahydro-2H-oxocine-8-carboxamide |
| SMILES | COc1ccc(COC[C@H]2O[C@@H](C(=O)N(C)C)C/C=C\C[C@H]2Cl)cc1 |
| InChI | InChI=1S/C19H26ClNO4/c1-21(2)19(22)17-7-5-4-6-16(20)18(25-17)13-24-12-14-8-10-15(23-3)11-9-14/h4-5,8-11,16-18H,6-7,12-13H2,1-3H3/b5-4-/t16-,17-,18-/m1/s1 |
| InChIKey | VVIHSLYPGDNLKN-RHIRGMCDSA-N |
| XLogP | 3.01 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.87 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|