C33H49NO5Si — CID 11421704
(2R,7S)-7-[(1S)-1-[(4-methoxyphenyl)methoxy]-3-phenylmethoxypropyl]-N,N-dimethyl-5-triethylsilyl-2,3,6,7-tetrahydrooxepine-2-carboxamide (PubChem CID 11421704) has the molecular formula C33H49NO5Si and a molecular weight of 567.84 g/mol. Its IUPAC name is (2R,7S)-7-[(1S)-1-[(4-methoxyphenyl)methoxy]-3-phenylmethoxypropyl]-N,N-dimethyl-5-triethylsilyl-2,3,6,7-tetrahydrooxepine-2-carboxamide.
| Compound Name | (2R,7S)-7-[(1S)-1-[(4-methoxyphenyl)methoxy]-3-phenylmethoxypropyl]-N,N-dimethyl-5-triethylsilyl-2,3,6,7-tetrahydrooxepine-2-carboxamide |
|---|---|
| PubChem CID | 11421704 |
| Molecular Formula | C33H49NO5Si |
| Molecular Weight | 567.84 g/mol |
| Exact Mass | 567.34 |
| IUPAC Name | (2R,7S)-7-[(1S)-1-[(4-methoxyphenyl)methoxy]-3-phenylmethoxypropyl]-N,N-dimethyl-5-triethylsilyl-2,3,6,7-tetrahydrooxepine-2-carboxamide |
| SMILES | CC[Si](CC)(CC)C1=CC[C@H](C(=O)N(C)C)O[C@H]([C@H](CCOCc2ccccc2)OCc2ccc(OC)cc2)C1 |
| InChI | InChI=1S/C33H49NO5Si/c1-7-40(8-2,9-3)29-19-20-31(33(35)34(4)5)39-32(23-29)30(21-22-37-24-26-13-11-10-12-14-26)38-25-27-15-17-28(36-6)18-16-27/h10-19,30-32H,7-9,20-25H2,1-6H3/t30-,31+,32-/m0/s1 |
| InChIKey | FOSUGQBRWMDALU-QAXCHELISA-N |
| XLogP | 6.80 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.84 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|