C27H42O7Si — CID 46702465
methyl (2R,3S,5E,8R)-3-[tert-butyl(dimethyl)silyl]oxy-6-formyl-8-[(1R)-1-[(4-methoxyphenyl)methoxy]propyl]-3,4,7,8-tetrahydro-2H-oxocine-2-carboxylate (PubChem CID 46702465) has the molecular formula C27H42O7Si and a molecular weight of 506.71 g/mol. Its IUPAC name is methyl (2R,3S,5E,8R)-3-[tert-butyl(dimethyl)silyl]oxy-6-formyl-8-[(1R)-1-[(4-methoxyphenyl)methoxy]propyl]-3,4,7,8-tetrahydro-2H-oxocine-2-carboxylate.
| Compound Name | methyl (2R,3S,5E,8R)-3-[tert-butyl(dimethyl)silyl]oxy-6-formyl-8-[(1R)-1-[(4-methoxyphenyl)methoxy]propyl]-3,4,7,8-tetrahydro-2H-oxocine-2-carboxylate |
|---|---|
| PubChem CID | 46702465 |
| Molecular Formula | C27H42O7Si |
| Molecular Weight | 506.71 g/mol |
| Exact Mass | 506.27 |
| IUPAC Name | methyl (2R,3S,5E,8R)-3-[tert-butyl(dimethyl)silyl]oxy-6-formyl-8-[(1R)-1-[(4-methoxyphenyl)methoxy]propyl]-3,4,7,8-tetrahydro-2H-oxocine-2-carboxylate |
| SMILES | CC[C@@H](OCc1ccc(OC)cc1)[C@H]1C/C(C=O)=C\C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C(=O)OC)O1 |
| InChI | InChI=1S/C27H42O7Si/c1-9-22(32-18-19-10-13-21(30-5)14-11-19)24-16-20(17-28)12-15-23(25(33-24)26(29)31-6)34-35(7,8)27(2,3)4/h10-14,17,22-25H,9,15-16,18H2,1-8H3/b20-12+/t22-,23+,24-,25-/m1/s1 |
| InChIKey | DZHDIAWVUSGNCE-TWUYYZIBSA-N |
| XLogP | 5.23 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.71 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|