C36H58O6Si — CID 25209768
methyl (2S)-2-[(2S,3S)-2-[(2E,4S,5R,6E)-5-[tert-butyl(dimethyl)silyl]oxy-4-ethyl-6-methylocta-2,6-dien-2-yl]-3-methyl-3,4-dihydro-2H-pyran-6-yl]-2-[(4-methoxyphenyl)methoxy]butanoate (PubChem CID 25209768) has the molecular formula C36H58O6Si and a molecular weight of 614.94 g/mol. Its IUPAC name is methyl (2S)-2-[(2S,3S)-2-[(2E,4S,5R,6E)-5-[tert-butyl(dimethyl)silyl]oxy-4-ethyl-6-methylocta-2,6-dien-2-yl]-3-methyl-3,4-dihydro-2H-pyran-6-yl]-2-[(4-methoxyphenyl)methoxy]butanoate.
| Compound Name | methyl (2S)-2-[(2S,3S)-2-[(2E,4S,5R,6E)-5-[tert-butyl(dimethyl)silyl]oxy-4-ethyl-6-methylocta-2,6-dien-2-yl]-3-methyl-3,4-dihydro-2H-pyran-6-yl]-2-[(4-methoxyphenyl)methoxy]butanoate |
|---|---|
| PubChem CID | 25209768 |
| Molecular Formula | C36H58O6Si |
| Molecular Weight | 614.94 g/mol |
| Exact Mass | 614.40 |
| IUPAC Name | methyl (2S)-2-[(2S,3S)-2-[(2E,4S,5R,6E)-5-[tert-butyl(dimethyl)silyl]oxy-4-ethyl-6-methylocta-2,6-dien-2-yl]-3-methyl-3,4-dihydro-2H-pyran-6-yl]-2-[(4-methoxyphenyl)methoxy]butanoate |
| SMILES | C/C=C(\C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](/C=C(\C)[C@H]1OC([C@](CC)(OCc2ccc(OC)cc2)C(=O)OC)=CC[C@@H]1C)CC |
| InChI | InChI=1S/C36H58O6Si/c1-14-25(4)33(42-43(12,13)35(7,8)9)29(15-2)23-27(6)32-26(5)17-22-31(41-32)36(16-3,34(37)39-11)40-24-28-18-20-30(38-10)21-19-28/h14,18-23,26,29,32-33H,15-17,24H2,1-13H3/b25-14+,27-23+/t26-,29-,32-,33-,36-/m0/s1 |
| InChIKey | QUISSRTXYZFDMS-ZPHLKREOSA-N |
| XLogP | 9.17 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.94 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|