C12H23N3O3 — CID 24839231
2-butyl-N,N-dicarbamoylhexanamide (PubChem CID 24839231) has the molecular formula C12H23N3O3 and a molecular weight of 257.33 g/mol. Its IUPAC name is 2-butyl-N,N-dicarbamoylhexanamide.
| Compound Name | 2-butyl-N,N-dicarbamoylhexanamide |
|---|---|
| PubChem CID | 24839231 |
| Molecular Formula | C12H23N3O3 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.17 |
| IUPAC Name | 2-butyl-N,N-dicarbamoylhexanamide |
| SMILES | CCCCC(CCCC)C(=O)N(C(N)=O)C(N)=O |
| InChI | InChI=1S/C12H23N3O3/c1-3-5-7-9(8-6-4-2)10(16)15(11(13)17)12(14)18/h9H,3-8H2,1-2H3,(H2,13,17)(H2,14,18) |
| InChIKey | XRUWGRIPUFYZEU-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |