C22H24BrN3O4 — CID 24905726
(Z)-5-(1,3-benzodioxol-5-yl)-5-[(5-bromo-2-pyridinyl)amino]-2-hydroxy-1-piperidin-1-ylpent-3-en-1-one (PubChem CID 24905726) has the molecular formula C22H24BrN3O4 and a molecular weight of 474.36 g/mol. Its IUPAC name is (Z)-5-(1,3-benzodioxol-5-yl)-5-[(5-bromo-2-pyridinyl)amino]-2-hydroxy-1-piperidin-1-ylpent-3-en-1-one.
| Compound Name | (Z)-5-(1,3-benzodioxol-5-yl)-5-[(5-bromo-2-pyridinyl)amino]-2-hydroxy-1-piperidin-1-ylpent-3-en-1-one |
|---|---|
| PubChem CID | 24905726 |
| Molecular Formula | C22H24BrN3O4 |
| Molecular Weight | 474.36 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | (Z)-5-(1,3-benzodioxol-5-yl)-5-[(5-bromo-2-pyridinyl)amino]-2-hydroxy-1-piperidin-1-ylpent-3-en-1-one |
| SMILES | O=C(C(O)/C=C\C(Nc1ccc(Br)cn1)c1ccc2c(c1)OCO2)N1CCCCC1 |
| InChI | InChI=1S/C22H24BrN3O4/c23-16-5-9-21(24-13-16)25-17(15-4-8-19-20(12-15)30-14-29-19)6-7-18(27)22(28)26-10-2-1-3-11-26/h4-9,12-13,17-18,27H,1-3,10-11,14H2,(H,24,25)/b7-6- |
| InChIKey | OPZLOVBWTDGOAK-SREVYHEPSA-N |
| XLogP | 3.66 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.36 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|