C17H14BrN3O4 — CID 56688965
1-[1,3-benzodioxol-5-yl-[(5-bromo-2-pyridinyl)amino]methyl]pyrrolidine-2,5-dione (PubChem CID 56688965) has the molecular formula C17H14BrN3O4 and a molecular weight of 404.22 g/mol. Its IUPAC name is 1-[1,3-benzodioxol-5-yl-[(5-bromo-2-pyridinyl)amino]methyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[1,3-benzodioxol-5-yl-[(5-bromo-2-pyridinyl)amino]methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 56688965 |
| Molecular Formula | C17H14BrN3O4 |
| Molecular Weight | 404.22 g/mol |
| Exact Mass | 403.02 |
| IUPAC Name | 1-[1,3-benzodioxol-5-yl-[(5-bromo-2-pyridinyl)amino]methyl]pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1C(Nc1ccc(Br)cn1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H14BrN3O4/c18-11-2-4-14(19-8-11)20-17(21-15(22)5-6-16(21)23)10-1-3-12-13(7-10)25-9-24-12/h1-4,7-8,17H,5-6,9H2,(H,19,20) |
| InChIKey | CKRMZSWPSABQNB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.22 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|