C18H15NO4 — CID 25178656
1-[1,3-benzodioxol-5-yl(phenyl)methyl]pyrrolidine-2,5-dione (PubChem CID 25178656) has the molecular formula C18H15NO4 and a molecular weight of 309.32 g/mol. Its IUPAC name is 1-[1,3-benzodioxol-5-yl(phenyl)methyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[1,3-benzodioxol-5-yl(phenyl)methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 25178656 |
| Molecular Formula | C18H15NO4 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 1-[1,3-benzodioxol-5-yl(phenyl)methyl]pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1C(c1ccccc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H15NO4/c20-16-8-9-17(21)19(16)18(12-4-2-1-3-5-12)13-6-7-14-15(10-13)23-11-22-14/h1-7,10,18H,8-9,11H2 |
| InChIKey | XCGZPKIEYATRKP-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|