C23H19Cl2NO4S — CID 24937317
(3R)-7-[3-(2,4-dichlorophenoxy)propyl]-5-oxo-8-phenyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyridine-3-carboxylic acid (PubChem CID 24937317) has the molecular formula C23H19Cl2NO4S and a molecular weight of 476.38 g/mol. Its IUPAC name is (3R)-7-[3-(2,4-dichlorophenoxy)propyl]-5-oxo-8-phenyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyridine-3-carboxylic acid.
| Compound Name | (3R)-7-[3-(2,4-dichlorophenoxy)propyl]-5-oxo-8-phenyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 24937317 |
| Molecular Formula | C23H19Cl2NO4S |
| Molecular Weight | 476.38 g/mol |
| Exact Mass | 475.04 |
| IUPAC Name | (3R)-7-[3-(2,4-dichlorophenoxy)propyl]-5-oxo-8-phenyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyridine-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CSc2c(-c3ccccc3)c(CCCOc3ccc(Cl)cc3Cl)cc(=O)n21 |
| InChI | InChI=1S/C23H19Cl2NO4S/c24-16-8-9-19(17(25)12-16)30-10-4-7-15-11-20(27)26-18(23(28)29)13-31-22(26)21(15)14-5-2-1-3-6-14/h1-3,5-6,8-9,11-12,18H,4,7,10,13H2,(H,28,29)/t18-/m0/s1 |
| InChIKey | KCGKKGRPMOUTBD-SFHVURJKSA-N |
| XLogP | 5.57 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.38 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|