C20H20O6S — CID 24939592
methyl (E)-3-[2-[(2R,3S)-3-[(4-methylphenyl)sulfonyloxymethyl]oxiran-2-yl]phenyl]prop-2-enoate (PubChem CID 24939592) has the molecular formula C20H20O6S and a molecular weight of 388.44 g/mol. Its IUPAC name is methyl (E)-3-[2-[(2R,3S)-3-[(4-methylphenyl)sulfonyloxymethyl]oxiran-2-yl]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[2-[(2R,3S)-3-[(4-methylphenyl)sulfonyloxymethyl]oxiran-2-yl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 24939592 |
| Molecular Formula | C20H20O6S |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | methyl (E)-3-[2-[(2R,3S)-3-[(4-methylphenyl)sulfonyloxymethyl]oxiran-2-yl]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccccc1[C@H]1O[C@H]1COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H20O6S/c1-14-7-10-16(11-8-14)27(22,23)25-13-18-20(26-18)17-6-4-3-5-15(17)9-12-19(21)24-2/h3-12,18,20H,13H2,1-2H3/b12-9+/t18-,20+/m0/s1 |
| InChIKey | ZXDMZBLPACGKBY-CQOFWLJFSA-N |
| XLogP | 3.03 |
| TPSA | 82.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|