C14H10Cl2N4 — CID 24968251
N-(2,4-dichlorophenyl)-6-pyrazol-1-ylpyridin-2-amine (PubChem CID 24968251) has the molecular formula C14H10Cl2N4 and a molecular weight of 305.17 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-6-pyrazol-1-ylpyridin-2-amine.
| Compound Name | N-(2,4-dichlorophenyl)-6-pyrazol-1-ylpyridin-2-amine |
|---|---|
| PubChem CID | 24968251 |
| Molecular Formula | C14H10Cl2N4 |
| Molecular Weight | 305.17 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | N-(2,4-dichlorophenyl)-6-pyrazol-1-ylpyridin-2-amine |
| SMILES | Clc1ccc(Nc2cccc(-n3cccn3)n2)c(Cl)c1 |
| InChI | InChI=1S/C14H10Cl2N4/c15-10-5-6-12(11(16)9-10)18-13-3-1-4-14(19-13)20-8-2-7-17-20/h1-9H,(H,18,19) |
| InChIKey | LUCYXIPEGFAMOS-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.17 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |