C10H16N2O12P2S — CID 25029380
[5-(5-hydroxy-4-oxo-2-sulfanylidenepyrimidin-1-yl)-4-methoxy-2-(phosphonooxymethyl)oxolan-3-yl] dihydrogen phosphate (PubChem CID 25029380) has the molecular formula C10H16N2O12P2S and a molecular weight of 450.26 g/mol. Its IUPAC name is [5-(5-hydroxy-4-oxo-2-sulfanylidenepyrimidin-1-yl)-4-methoxy-2-(phosphonooxymethyl)oxolan-3-yl] dihydrogen phosphate.
| Compound Name | [5-(5-hydroxy-4-oxo-2-sulfanylidenepyrimidin-1-yl)-4-methoxy-2-(phosphonooxymethyl)oxolan-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 25029380 |
| Molecular Formula | C10H16N2O12P2S |
| Molecular Weight | 450.26 g/mol |
| Exact Mass | 449.99 |
| IUPAC Name | [5-(5-hydroxy-4-oxo-2-sulfanylidenepyrimidin-1-yl)-4-methoxy-2-(phosphonooxymethyl)oxolan-3-yl] dihydrogen phosphate |
| SMILES | COC1C(OP(=O)(O)O)C(COP(=O)(O)O)OC1n1cc(O)c(=O)[nH]c1=S |
| InChI | InChI=1S/C10H16N2O12P2S/c1-21-7-6(24-26(18,19)20)5(3-22-25(15,16)17)23-9(7)12-2-4(13)8(14)11-10(12)27/h2,5-7,9,13H,3H2,1H3,(H,11,14,27)(H2,15,16,17)(H2,18,19,20) |
| InChIKey | MCILHIOVWGXSGN-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 210.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.26 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|