C18H23Cl2NO2S — CID 25038871
N-[1-(2-adamantyl)ethyl]-2,5-dichlorobenzenesulfonamide (PubChem CID 25038871) has the molecular formula C18H23Cl2NO2S and a molecular weight of 388.36 g/mol. Its IUPAC name is N-[1-(2-adamantyl)ethyl]-2,5-dichlorobenzenesulfonamide.
| Compound Name | N-[1-(2-adamantyl)ethyl]-2,5-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 25038871 |
| Molecular Formula | C18H23Cl2NO2S |
| Molecular Weight | 388.36 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | N-[1-(2-adamantyl)ethyl]-2,5-dichlorobenzenesulfonamide |
| SMILES | CC(NS(=O)(=O)c1cc(Cl)ccc1Cl)C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C18H23Cl2NO2S/c1-10(18-13-5-11-4-12(7-13)8-14(18)6-11)21-24(22,23)17-9-15(19)2-3-16(17)20/h2-3,9-14,18,21H,4-8H2,1H3 |
| InChIKey | LQUFCEUDMUETCU-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.36 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |