C21H24N6OS — CID 25093460
2-amino-N-ethyl-3-[3-[12-methyl-8-(methylamino)-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-4-yl]phenyl]propanamide (PubChem CID 25093460) has the molecular formula C21H24N6OS and a molecular weight of 408.53 g/mol. Its IUPAC name is 2-amino-N-ethyl-3-[3-[12-methyl-8-(methylamino)-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-4-yl]phenyl]propanamide.
| Compound Name | 2-amino-N-ethyl-3-[3-[12-methyl-8-(methylamino)-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-4-yl]phenyl]propanamide |
|---|---|
| PubChem CID | 25093460 |
| Molecular Formula | C21H24N6OS |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 2-amino-N-ethyl-3-[3-[12-methyl-8-(methylamino)-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-4-yl]phenyl]propanamide |
| SMILES | CCNC(=O)C(N)Cc1cccc(-c2cc3nc(NC)c4ncc(C)n4c3s2)c1 |
| InChI | InChI=1S/C21H24N6OS/c1-4-24-20(28)15(22)9-13-6-5-7-14(8-13)17-10-16-21(29-17)27-12(2)11-25-19(27)18(23-3)26-16/h5-8,10-11,15H,4,9,22H2,1-3H3,(H,23,26)(H,24,28) |
| InChIKey | PPTMHEJDLKABRA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 97.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |