C18H13N3O3S — CID 25094943
N'-(4H-indeno[1,2-d][1,3]thiazol-2-yl)-1,3-benzodioxole-5-carbohydrazide (PubChem CID 25094943) has the molecular formula C18H13N3O3S and a molecular weight of 351.39 g/mol. Its IUPAC name is N'-(4H-indeno[1,2-d][1,3]thiazol-2-yl)-1,3-benzodioxole-5-carbohydrazide.
| Compound Name | N'-(4H-indeno[1,2-d][1,3]thiazol-2-yl)-1,3-benzodioxole-5-carbohydrazide |
|---|---|
| PubChem CID | 25094943 |
| Molecular Formula | C18H13N3O3S |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | N'-(4H-indeno[1,2-d][1,3]thiazol-2-yl)-1,3-benzodioxole-5-carbohydrazide |
| SMILES | O=C(NNc1nc2c(s1)Cc1ccccc1-2)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H13N3O3S/c22-17(11-5-6-13-14(7-11)24-9-23-13)20-21-18-19-16-12-4-2-1-3-10(12)8-15(16)25-18/h1-7H,8-9H2,(H,19,21)(H,20,22) |
| InChIKey | KURBZWAYKKSLPV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|