C26H32O3Si — CID 25104770
(2R,3R,4S)-3-[tert-butyl(diphenyl)silyl]oxy-4-[(1E,3E)-penta-1,3-dienyl]oxolane-2-carbaldehyde (PubChem CID 25104770) has the molecular formula C26H32O3Si and a molecular weight of 420.63 g/mol. Its IUPAC name is (2R,3R,4S)-3-[tert-butyl(diphenyl)silyl]oxy-4-[(1E,3E)-penta-1,3-dienyl]oxolane-2-carbaldehyde.
| Compound Name | (2R,3R,4S)-3-[tert-butyl(diphenyl)silyl]oxy-4-[(1E,3E)-penta-1,3-dienyl]oxolane-2-carbaldehyde |
|---|---|
| PubChem CID | 25104770 |
| Molecular Formula | C26H32O3Si |
| Molecular Weight | 420.63 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | (2R,3R,4S)-3-[tert-butyl(diphenyl)silyl]oxy-4-[(1E,3E)-penta-1,3-dienyl]oxolane-2-carbaldehyde |
| SMILES | C/C=C/C=C/[C@H]1CO[C@@H](C=O)[C@@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H32O3Si/c1-5-6-9-14-21-20-28-24(19-27)25(21)29-30(26(2,3)4,22-15-10-7-11-16-22)23-17-12-8-13-18-23/h5-19,21,24-25H,20H2,1-4H3/b6-5+,14-9+/t21-,24-,25+/m0/s1 |
| InChIKey | JZQSJUNPKLIANS-XHWZSDQMSA-N |
| XLogP | 4.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.63 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|