C24H48O5Si2 — CID 25137600
ethyl (2E,4E,7R)-7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-4-(2-hydroxyethyl)octa-2,4-dienoate (PubChem CID 25137600) has the molecular formula C24H48O5Si2 and a molecular weight of 472.82 g/mol. Its IUPAC name is ethyl (2E,4E,7R)-7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-4-(2-hydroxyethyl)octa-2,4-dienoate.
| Compound Name | ethyl (2E,4E,7R)-7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-4-(2-hydroxyethyl)octa-2,4-dienoate |
|---|---|
| PubChem CID | 25137600 |
| Molecular Formula | C24H48O5Si2 |
| Molecular Weight | 472.82 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | ethyl (2E,4E,7R)-7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-4-(2-hydroxyethyl)octa-2,4-dienoate |
| SMILES | CCOC(=O)/C=C/C(=C/C[C@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)CCO |
| InChI | InChI=1S/C24H48O5Si2/c1-12-27-22(26)16-14-20(17-18-25)13-15-21(29-31(10,11)24(5,6)7)19-28-30(8,9)23(2,3)4/h13-14,16,21,25H,12,15,17-19H2,1-11H3/b16-14+,20-13-/t21-/m1/s1 |
| InChIKey | HSULIVOEXQMWGY-SCWIGDQXSA-N |
| XLogP | 6.22 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.82 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|