C19H27N3O6S — CID 25146911
(2R,3R,4S,5R,6R)-2-[(1R,2R)-2-hydroxy-1-[4-(phenylmethoxymethyl)triazol-1-yl]propyl]-6-methylsulfanyloxane-3,4,5-triol (PubChem CID 25146911) has the molecular formula C19H27N3O6S and a molecular weight of 425.51 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2-[(1R,2R)-2-hydroxy-1-[4-(phenylmethoxymethyl)triazol-1-yl]propyl]-6-methylsulfanyloxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R,6R)-2-[(1R,2R)-2-hydroxy-1-[4-(phenylmethoxymethyl)triazol-1-yl]propyl]-6-methylsulfanyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 25146911 |
| Molecular Formula | C19H27N3O6S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-[(1R,2R)-2-hydroxy-1-[4-(phenylmethoxymethyl)triazol-1-yl]propyl]-6-methylsulfanyloxane-3,4,5-triol |
| SMILES | CS[C@H]1O[C@H]([C@@H]([C@@H](C)O)n2cc(COCc3ccccc3)nn2)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C19H27N3O6S/c1-11(23)14(18-16(25)15(24)17(26)19(28-18)29-2)22-8-13(20-21-22)10-27-9-12-6-4-3-5-7-12/h3-8,11,14-19,23-26H,9-10H2,1-2H3/t11-,14-,15+,16-,17-,18-,19-/m1/s1 |
| InChIKey | MYNDCASHKXHZMT-JAEYZEFRSA-N |
| XLogP | 0.09 |
| TPSA | 130.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |