C10H11N3O — CID 25157666
11-methoxy-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraene (PubChem CID 25157666) has the molecular formula C10H11N3O and a molecular weight of 189.22 g/mol. Its IUPAC name is 11-methoxy-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraene.
| Compound Name | 11-methoxy-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraene |
|---|---|
| PubChem CID | 25157666 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 11-methoxy-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraene |
| SMILES | COc1ccc2nc3n(c2n1)CCC3 |
| InChI | InChI=1S/C10H11N3O/c1-14-9-5-4-7-10(12-9)13-6-2-3-8(13)11-7/h4-5H,2-3,6H2,1H3 |
| InChIKey | PZZSRELIEPQEKK-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |