C31H31NO8 — CID 25179397
(2,5-dioxopyrrolidin-1-yl) 6-[9-hydroxy-6-methoxy-9-(4-methoxyphenyl)xanthen-3-yl]hexanoate (PubChem CID 25179397) has the molecular formula C31H31NO8 and a molecular weight of 545.59 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-[9-hydroxy-6-methoxy-9-(4-methoxyphenyl)xanthen-3-yl]hexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-[9-hydroxy-6-methoxy-9-(4-methoxyphenyl)xanthen-3-yl]hexanoate |
|---|---|
| PubChem CID | 25179397 |
| Molecular Formula | C31H31NO8 |
| Molecular Weight | 545.59 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-[9-hydroxy-6-methoxy-9-(4-methoxyphenyl)xanthen-3-yl]hexanoate |
| SMILES | COc1ccc(C2(O)c3ccc(CCCCCC(=O)ON4C(=O)CCC4=O)cc3Oc3cc(OC)ccc32)cc1 |
| InChI | InChI=1S/C31H31NO8/c1-37-22-11-9-21(10-12-22)31(36)24-14-8-20(18-26(24)39-27-19-23(38-2)13-15-25(27)31)6-4-3-5-7-30(35)40-32-28(33)16-17-29(32)34/h8-15,18-19,36H,3-7,16-17H2,1-2H3 |
| InChIKey | DHWOYQXJDNGNSX-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.59 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|